C12H16N2O2 — CID 106190462
6-[(3-methylbut-2-enylamino)methyl]pyridine-2-carboxylic acid (PubChem CID 106190462) has the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. Its IUPAC name is 6-[(3-methylbut-2-enylamino)methyl]pyridine-2-carboxylic acid.
| Compound Name | 6-[(3-methylbut-2-enylamino)methyl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 106190462 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | 6-[(3-methylbut-2-enylamino)methyl]pyridine-2-carboxylic acid |
| SMILES | CC(C)=CCNCc1cccc(C(=O)O)n1 |
| InChI | InChI=1S/C12H16N2O2/c1-9(2)6-7-13-8-10-4-3-5-11(14-10)12(15)16/h3-6,13H,7-8H2,1-2H3,(H,15,16) |
| InChIKey | UFDMSUJKFBKLAH-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|