C12H11NO3S — CID 61397512
5-(benzylsulfanylmethyl)-1,2-oxazole-3-carboxylic acid (PubChem CID 61397512) has the molecular formula C12H11NO3S and a molecular weight of 249.29 g/mol. Its IUPAC name is 5-(benzylsulfanylmethyl)-1,2-oxazole-3-carboxylic acid.
| Compound Name | 5-(benzylsulfanylmethyl)-1,2-oxazole-3-carboxylic acid |
|---|---|
| PubChem CID | 61397512 |
| Molecular Formula | C12H11NO3S |
| Molecular Weight | 249.29 g/mol |
| Exact Mass | 249.05 |
| IUPAC Name | 5-(benzylsulfanylmethyl)-1,2-oxazole-3-carboxylic acid |
| SMILES | O=C(O)c1cc(CSCc2ccccc2)on1 |
| InChI | InChI=1S/C12H11NO3S/c14-12(15)11-6-10(16-13-11)8-17-7-9-4-2-1-3-5-9/h1-6H,7-8H2,(H,14,15) |
| InChIKey | GWNUUYCZFDZOBL-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.29 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |