C11H9FN2O3S — CID 61397385
5-[(2-amino-4-fluorophenyl)sulfanylmethyl]-1,2-oxazole-3-carboxylic acid (PubChem CID 61397385) has the molecular formula C11H9FN2O3S and a molecular weight of 268.27 g/mol. Its IUPAC name is 5-[(2-amino-4-fluorophenyl)sulfanylmethyl]-1,2-oxazole-3-carboxylic acid.
| Compound Name | 5-[(2-amino-4-fluorophenyl)sulfanylmethyl]-1,2-oxazole-3-carboxylic acid |
|---|---|
| PubChem CID | 61397385 |
| Molecular Formula | C11H9FN2O3S |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.03 |
| IUPAC Name | 5-[(2-amino-4-fluorophenyl)sulfanylmethyl]-1,2-oxazole-3-carboxylic acid |
| SMILES | Nc1cc(F)ccc1SCc1cc(C(=O)O)no1 |
| InChI | InChI=1S/C11H9FN2O3S/c12-6-1-2-10(8(13)3-6)18-5-7-4-9(11(15)16)14-17-7/h1-4H,5,13H2,(H,15,16) |
| InChIKey | ZAKGUAAQKXVTKN-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|