C10H10FN3OS — CID 43304327
5-fluoro-2-[(3-methyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]aniline (PubChem CID 43304327) has the molecular formula C10H10FN3OS and a molecular weight of 239.28 g/mol. Its IUPAC name is 5-fluoro-2-[(3-methyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]aniline.
| Compound Name | 5-fluoro-2-[(3-methyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]aniline |
|---|---|
| PubChem CID | 43304327 |
| Molecular Formula | C10H10FN3OS |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.05 |
| IUPAC Name | 5-fluoro-2-[(3-methyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]aniline |
| SMILES | Cc1noc(CSc2ccc(F)cc2N)n1 |
| InChI | InChI=1S/C10H10FN3OS/c1-6-13-10(15-14-6)5-16-9-3-2-7(11)4-8(9)12/h2-4H,5,12H2,1H3 |
| InChIKey | ZTFZLAJRJADOON-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|