C4H3NO2S2 — CID 88841214
1,3-thiazol-2-ylsulfanylformic acid (PubChem CID 88841214) has the molecular formula C4H3NO2S2 and a molecular weight of 161.21 g/mol. Its IUPAC name is 1,3-thiazol-2-ylsulfanylformic acid.
| Compound Name | 1,3-thiazol-2-ylsulfanylformic acid |
|---|---|
| PubChem CID | 88841214 |
| Molecular Formula | C4H3NO2S2 |
| Molecular Weight | 161.21 g/mol |
| Exact Mass | 160.96 |
| IUPAC Name | 1,3-thiazol-2-ylsulfanylformic acid |
| SMILES | O=C(O)Sc1nccs1 |
| InChI | InChI=1S/C4H3NO2S2/c6-4(7)9-3-5-1-2-8-3/h1-2H,(H,6,7) |
| InChIKey | FMZOFALNKRKXST-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.21 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|