C8H12N2S3 — CID 150695189
1,3-thiazol-2-yl N,N-diethylcarbamodithioate (PubChem CID 150695189) has the molecular formula C8H12N2S3 and a molecular weight of 232.40 g/mol. Its IUPAC name is 1,3-thiazol-2-yl N,N-diethylcarbamodithioate.
| Compound Name | 1,3-thiazol-2-yl N,N-diethylcarbamodithioate |
|---|---|
| PubChem CID | 150695189 |
| Molecular Formula | C8H12N2S3 |
| Molecular Weight | 232.40 g/mol |
| Exact Mass | 232.02 |
| IUPAC Name | 1,3-thiazol-2-yl N,N-diethylcarbamodithioate |
| SMILES | CCN(CC)C(=S)Sc1nccs1 |
| InChI | InChI=1S/C8H12N2S3/c1-3-10(4-2)8(11)13-7-9-5-6-12-7/h5-6H,3-4H2,1-2H3 |
| InChIKey | JKRUHHRUDYROKL-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.40 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|