C10H14N6S2 — CID 80885759
2-N,2-N-diethyl-6-(1,3-thiazol-2-ylsulfanyl)-1,3,5-triazine-2,4-diamine (PubChem CID 80885759) has the molecular formula C10H14N6S2 and a molecular weight of 282.40 g/mol. Its IUPAC name is 2-N,2-N-diethyl-6-(1,3-thiazol-2-ylsulfanyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N,2-N-diethyl-6-(1,3-thiazol-2-ylsulfanyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 80885759 |
| Molecular Formula | C10H14N6S2 |
| Molecular Weight | 282.40 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | 2-N,2-N-diethyl-6-(1,3-thiazol-2-ylsulfanyl)-1,3,5-triazine-2,4-diamine |
| SMILES | CCN(CC)c1nc(N)nc(Sc2nccs2)n1 |
| InChI | InChI=1S/C10H14N6S2/c1-3-16(4-2)8-13-7(11)14-9(15-8)18-10-12-5-6-17-10/h5-6H,3-4H2,1-2H3,(H2,11,13,14,15) |
| InChIKey | RCKFLSBGGUZSHS-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 80.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.40 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|