C7H6N4S2 — CID 116798231
2-(1,3-thiazol-2-ylsulfanyl)pyrimidin-4-amine (PubChem CID 116798231) has the molecular formula C7H6N4S2 and a molecular weight of 210.29 g/mol. Its IUPAC name is 2-(1,3-thiazol-2-ylsulfanyl)pyrimidin-4-amine.
| Compound Name | 2-(1,3-thiazol-2-ylsulfanyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 116798231 |
| Molecular Formula | C7H6N4S2 |
| Molecular Weight | 210.29 g/mol |
| Exact Mass | 210.00 |
| IUPAC Name | 2-(1,3-thiazol-2-ylsulfanyl)pyrimidin-4-amine |
| SMILES | Nc1ccnc(Sc2nccs2)n1 |
| InChI | InChI=1S/C7H6N4S2/c8-5-1-2-9-6(11-5)13-7-10-3-4-12-7/h1-4H,(H2,8,9,11) |
| InChIKey | UTENFQYPINFHOT-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.29 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|