C6H5N5S2 — CID 116798322
2-(1,2,4-thiadiazol-5-ylsulfanyl)pyrimidin-4-amine (PubChem CID 116798322) has the molecular formula C6H5N5S2 and a molecular weight of 211.28 g/mol. Its IUPAC name is 2-(1,2,4-thiadiazol-5-ylsulfanyl)pyrimidin-4-amine.
| Compound Name | 2-(1,2,4-thiadiazol-5-ylsulfanyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 116798322 |
| Molecular Formula | C6H5N5S2 |
| Molecular Weight | 211.28 g/mol |
| Exact Mass | 211.00 |
| IUPAC Name | 2-(1,2,4-thiadiazol-5-ylsulfanyl)pyrimidin-4-amine |
| SMILES | Nc1ccnc(Sc2ncns2)n1 |
| InChI | InChI=1S/C6H5N5S2/c7-4-1-2-8-5(11-4)12-6-9-3-10-13-6/h1-3H,(H2,7,8,11) |
| InChIKey | NAPPNFZHHMHUKX-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 77.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.28 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |