About 2-(1,2,4-thiadiazol-5-ylsulfanyl)pyrimidin-4-amine
2-(1,2,4-thiadiazol-5-ylsulfanyl)pyrimidin-4-amine (PubChem CID 116798322) has the molecular formula C6H5N5S2
and a molecular weight of 211.28 g/mol. Its IUPAC name is 2-(1,2,4-thiadiazol-5-ylsulfanyl)pyrimidin-4-amine.
Molecular Properties
| Compound Name | 2-(1,2,4-thiadiazol-5-ylsulfanyl)pyrimidin-4-amine |
| PubChem CID | 116798322 |
| Molecular Formula | C6H5N5S2 |
| Molecular Weight | 211.28 g/mol |
| Exact Mass | 211.00 |
| IUPAC Name | 2-(1,2,4-thiadiazol-5-ylsulfanyl)pyrimidin-4-amine |
| SMILES | Nc1ccnc(Sc2ncns2)n1 |
| InChI | InChI=1S/C6H5N5S2/c7-4-1-2-8-5(11-4)12-6-9-3-10-13-6/h1-3H,(H2,7,8,11) |
| InChIKey | NAPPNFZHHMHUKX-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 77.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.28 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-(1,2,4-thiadiazol-5-ylsulfanyl)pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,2,4-thiadiazol-5-ylsulfanyl)pyrimidin-4-amine?
The IUPAC name of 2-(1,2,4-thiadiazol-5-ylsulfanyl)pyrimidin-4-amine (CID 116798322) is 2-(1,2,4-thiadiazol-5-ylsulfanyl)pyrimidin-4-amine.
What is the SMILES notation for 2-(1,2,4-thiadiazol-5-ylsulfanyl)pyrimidin-4-amine?
The canonical SMILES for 2-(1,2,4-thiadiazol-5-ylsulfanyl)pyrimidin-4-amine is Nc1ccnc(Sc2ncns2)n1.
What is the InChIKey of 2-(1,2,4-thiadiazol-5-ylsulfanyl)pyrimidin-4-amine?
The InChIKey is NAPPNFZHHMHUKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N5S2/c7-4-1-2-8-5(11-4)12-6-9-3-10-13-6/h1-3H,(H2,7,8,11).
What are the key properties of 2-(1,2,4-thiadiazol-5-ylsulfanyl)pyrimidin-4-amine?
2-(1,2,4-thiadiazol-5-ylsulfanyl)pyrimidin-4-amine has a molecular weight of 211.28 g/mol, XLogP of 1.06, 2 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,2,4-thiadiazol-5-ylsulfanyl)pyrimidin-4-amine is sourced from PubChem (CID 116798322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).