About 2-(2,4,6-trimethoxypyrimidin-5-yl)sulfanylpyrimidin-4-amine
2-(2,4,6-trimethoxypyrimidin-5-yl)sulfanylpyrimidin-4-amine (PubChem CID 121224759) has the molecular formula C11H13N5O3S
and a molecular weight of 295.32 g/mol. Its IUPAC name is 2-(2,4,6-trimethoxypyrimidin-5-yl)sulfanylpyrimidin-4-amine.
Molecular Properties
| Compound Name | 2-(2,4,6-trimethoxypyrimidin-5-yl)sulfanylpyrimidin-4-amine |
| PubChem CID | 121224759 |
| Molecular Formula | C11H13N5O3S |
| Molecular Weight | 295.32 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | 2-(2,4,6-trimethoxypyrimidin-5-yl)sulfanylpyrimidin-4-amine |
| SMILES | COc1nc(OC)c(Sc2nccc(N)n2)c(OC)n1 |
| InChI | InChI=1S/C11H13N5O3S/c1-17-8-7(9(18-2)16-10(15-8)19-3)20-11-13-5-4-6(12)14-11/h4-5H,1-3H3,(H2,12,13,14) |
| InChIKey | KRQONNTVXBFDHK-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 105.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.32 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze 2-(2,4,6-trimethoxypyrimidin-5-yl)sulfanylpyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,4,6-trimethoxypyrimidin-5-yl)sulfanylpyrimidin-4-amine?
The IUPAC name of 2-(2,4,6-trimethoxypyrimidin-5-yl)sulfanylpyrimidin-4-amine (CID 121224759) is 2-(2,4,6-trimethoxypyrimidin-5-yl)sulfanylpyrimidin-4-amine.
What is the SMILES notation for 2-(2,4,6-trimethoxypyrimidin-5-yl)sulfanylpyrimidin-4-amine?
The canonical SMILES for 2-(2,4,6-trimethoxypyrimidin-5-yl)sulfanylpyrimidin-4-amine is COc1nc(OC)c(Sc2nccc(N)n2)c(OC)n1.
What is the InChIKey of 2-(2,4,6-trimethoxypyrimidin-5-yl)sulfanylpyrimidin-4-amine?
The InChIKey is KRQONNTVXBFDHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N5O3S/c1-17-8-7(9(18-2)16-10(15-8)19-3)20-11-13-5-4-6(12)14-11/h4-5H,1-3H3,(H2,12,13,14).
What are the key properties of 2-(2,4,6-trimethoxypyrimidin-5-yl)sulfanylpyrimidin-4-amine?
2-(2,4,6-trimethoxypyrimidin-5-yl)sulfanylpyrimidin-4-amine has a molecular weight of 295.32 g/mol, XLogP of 1.03, 5 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4,6-trimethoxypyrimidin-5-yl)sulfanylpyrimidin-4-amine is sourced from PubChem (CID 121224759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).