C11H13N5O3S — CID 121224759
2-(2,4,6-trimethoxypyrimidin-5-yl)sulfanylpyrimidin-4-amine (PubChem CID 121224759) has the molecular formula C11H13N5O3S and a molecular weight of 295.32 g/mol. Its IUPAC name is 2-(2,4,6-trimethoxypyrimidin-5-yl)sulfanylpyrimidin-4-amine.
| Compound Name | 2-(2,4,6-trimethoxypyrimidin-5-yl)sulfanylpyrimidin-4-amine |
|---|---|
| PubChem CID | 121224759 |
| Molecular Formula | C11H13N5O3S |
| Molecular Weight | 295.32 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | 2-(2,4,6-trimethoxypyrimidin-5-yl)sulfanylpyrimidin-4-amine |
| SMILES | COc1nc(OC)c(Sc2nccc(N)n2)c(OC)n1 |
| InChI | InChI=1S/C11H13N5O3S/c1-17-8-7(9(18-2)16-10(15-8)19-3)20-11-13-5-4-6(12)14-11/h4-5H,1-3H3,(H2,12,13,14) |
| InChIKey | KRQONNTVXBFDHK-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 105.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.32 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |