About 4-(1,2,4-thiadiazol-5-ylsulfanyl)benzene-1,2-diamine
4-(1,2,4-thiadiazol-5-ylsulfanyl)benzene-1,2-diamine (PubChem CID 106748859) has the molecular formula C8H8N4S2
and a molecular weight of 224.31 g/mol. Its IUPAC name is 4-(1,2,4-thiadiazol-5-ylsulfanyl)benzene-1,2-diamine.
Molecular Properties
| Compound Name | 4-(1,2,4-thiadiazol-5-ylsulfanyl)benzene-1,2-diamine |
| PubChem CID | 106748859 |
| Molecular Formula | C8H8N4S2 |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.02 |
| IUPAC Name | 4-(1,2,4-thiadiazol-5-ylsulfanyl)benzene-1,2-diamine |
| SMILES | Nc1ccc(Sc2ncns2)cc1N |
| InChI | InChI=1S/C8H8N4S2/c9-6-2-1-5(3-7(6)10)13-8-11-4-12-14-8/h1-4H,9-10H2 |
| InChIKey | WSUHFLFTVLRBBN-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-(1,2,4-thiadiazol-5-ylsulfanyl)benzene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,2,4-thiadiazol-5-ylsulfanyl)benzene-1,2-diamine?
The IUPAC name of 4-(1,2,4-thiadiazol-5-ylsulfanyl)benzene-1,2-diamine (CID 106748859) is 4-(1,2,4-thiadiazol-5-ylsulfanyl)benzene-1,2-diamine.
What is the SMILES notation for 4-(1,2,4-thiadiazol-5-ylsulfanyl)benzene-1,2-diamine?
The canonical SMILES for 4-(1,2,4-thiadiazol-5-ylsulfanyl)benzene-1,2-diamine is Nc1ccc(Sc2ncns2)cc1N.
What is the InChIKey of 4-(1,2,4-thiadiazol-5-ylsulfanyl)benzene-1,2-diamine?
The InChIKey is WSUHFLFTVLRBBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N4S2/c9-6-2-1-5(3-7(6)10)13-8-11-4-12-14-8/h1-4H,9-10H2.
What are the key properties of 4-(1,2,4-thiadiazol-5-ylsulfanyl)benzene-1,2-diamine?
4-(1,2,4-thiadiazol-5-ylsulfanyl)benzene-1,2-diamine has a molecular weight of 224.31 g/mol, XLogP of 1.85, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,2,4-thiadiazol-5-ylsulfanyl)benzene-1,2-diamine is sourced from PubChem (CID 106748859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).