C8H8N4S2 — CID 106748859
4-(1,2,4-thiadiazol-5-ylsulfanyl)benzene-1,2-diamine (PubChem CID 106748859) has the molecular formula C8H8N4S2 and a molecular weight of 224.31 g/mol. Its IUPAC name is 4-(1,2,4-thiadiazol-5-ylsulfanyl)benzene-1,2-diamine.
| Compound Name | 4-(1,2,4-thiadiazol-5-ylsulfanyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 106748859 |
| Molecular Formula | C8H8N4S2 |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.02 |
| IUPAC Name | 4-(1,2,4-thiadiazol-5-ylsulfanyl)benzene-1,2-diamine |
| SMILES | Nc1ccc(Sc2ncns2)cc1N |
| InChI | InChI=1S/C8H8N4S2/c9-6-2-1-5(3-7(6)10)13-8-11-4-12-14-8/h1-4H,9-10H2 |
| InChIKey | WSUHFLFTVLRBBN-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|