C12H10N4S2 — CID 102714165
3-methyl-5-(1,2,4-thiadiazol-5-ylsulfanyl)isoquinolin-8-amine (PubChem CID 102714165) has the molecular formula C12H10N4S2 and a molecular weight of 274.37 g/mol. Its IUPAC name is 3-methyl-5-(1,2,4-thiadiazol-5-ylsulfanyl)isoquinolin-8-amine.
| Compound Name | 3-methyl-5-(1,2,4-thiadiazol-5-ylsulfanyl)isoquinolin-8-amine |
|---|---|
| PubChem CID | 102714165 |
| Molecular Formula | C12H10N4S2 |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.03 |
| IUPAC Name | 3-methyl-5-(1,2,4-thiadiazol-5-ylsulfanyl)isoquinolin-8-amine |
| SMILES | Cc1cc2c(Sc3ncns3)ccc(N)c2cn1 |
| InChI | InChI=1S/C12H10N4S2/c1-7-4-8-9(5-14-7)10(13)2-3-11(8)17-12-15-6-16-18-12/h2-6H,13H2,1H3 |
| InChIKey | MZTVVILIZNDHPO-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|