C8H6ClFN4S2 — CID 103553925
4-chloro-5-fluoro-6-(1,2,4-thiadiazol-5-ylsulfanyl)benzene-1,3-diamine (PubChem CID 103553925) has the molecular formula C8H6ClFN4S2 and a molecular weight of 276.75 g/mol. Its IUPAC name is 4-chloro-5-fluoro-6-(1,2,4-thiadiazol-5-ylsulfanyl)benzene-1,3-diamine.
| Compound Name | 4-chloro-5-fluoro-6-(1,2,4-thiadiazol-5-ylsulfanyl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 103553925 |
| Molecular Formula | C8H6ClFN4S2 |
| Molecular Weight | 276.75 g/mol |
| Exact Mass | 275.97 |
| IUPAC Name | 4-chloro-5-fluoro-6-(1,2,4-thiadiazol-5-ylsulfanyl)benzene-1,3-diamine |
| SMILES | Nc1cc(N)c(Sc2ncns2)c(F)c1Cl |
| InChI | InChI=1S/C8H6ClFN4S2/c9-5-3(11)1-4(12)7(6(5)10)15-8-13-2-14-16-8/h1-2H,11-12H2 |
| InChIKey | GSUVLGANRMPAEE-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.75 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|