C11H16ClFN2S — CID 107747951
4-chloro-5-fluoro-6-(3-methylbutan-2-ylsulfanyl)benzene-1,3-diamine (PubChem CID 107747951) has the molecular formula C11H16ClFN2S and a molecular weight of 262.78 g/mol. Its IUPAC name is 4-chloro-5-fluoro-6-(3-methylbutan-2-ylsulfanyl)benzene-1,3-diamine.
| Compound Name | 4-chloro-5-fluoro-6-(3-methylbutan-2-ylsulfanyl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 107747951 |
| Molecular Formula | C11H16ClFN2S |
| Molecular Weight | 262.78 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | 4-chloro-5-fluoro-6-(3-methylbutan-2-ylsulfanyl)benzene-1,3-diamine |
| SMILES | CC(C)C(C)Sc1c(N)cc(N)c(Cl)c1F |
| InChI | InChI=1S/C11H16ClFN2S/c1-5(2)6(3)16-11-8(15)4-7(14)9(12)10(11)13/h4-6H,14-15H2,1-3H3 |
| InChIKey | WRLUKMXYWAWCSI-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.78 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|