C10H14ClFN2S — CID 103553859
4-butan-2-ylsulfanyl-6-chloro-5-fluorobenzene-1,3-diamine (PubChem CID 103553859) has the molecular formula C10H14ClFN2S and a molecular weight of 248.75 g/mol. Its IUPAC name is 4-butan-2-ylsulfanyl-6-chloro-5-fluorobenzene-1,3-diamine.
| Compound Name | 4-butan-2-ylsulfanyl-6-chloro-5-fluorobenzene-1,3-diamine |
|---|---|
| PubChem CID | 103553859 |
| Molecular Formula | C10H14ClFN2S |
| Molecular Weight | 248.75 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | 4-butan-2-ylsulfanyl-6-chloro-5-fluorobenzene-1,3-diamine |
| SMILES | CCC(C)Sc1c(N)cc(N)c(Cl)c1F |
| InChI | InChI=1S/C10H14ClFN2S/c1-3-5(2)15-10-7(14)4-6(13)8(11)9(10)12/h4-5H,3,13-14H2,1-2H3 |
| InChIKey | LFEOXVDVUIPTSA-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.75 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|