C10H13ClFN3OS — CID 114233299
2-(4,6-diamino-3-chloro-2-fluorophenyl)sulfanyl-N,N-dimethylacetamide (PubChem CID 114233299) has the molecular formula C10H13ClFN3OS and a molecular weight of 277.75 g/mol. Its IUPAC name is 2-(4,6-diamino-3-chloro-2-fluorophenyl)sulfanyl-N,N-dimethylacetamide.
| Compound Name | 2-(4,6-diamino-3-chloro-2-fluorophenyl)sulfanyl-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 114233299 |
| Molecular Formula | C10H13ClFN3OS |
| Molecular Weight | 277.75 g/mol |
| Exact Mass | 277.05 |
| IUPAC Name | 2-(4,6-diamino-3-chloro-2-fluorophenyl)sulfanyl-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)CSc1c(N)cc(N)c(Cl)c1F |
| InChI | InChI=1S/C10H13ClFN3OS/c1-15(2)7(16)4-17-10-6(14)3-5(13)8(11)9(10)12/h3H,4,13-14H2,1-2H3 |
| InChIKey | SDNRYPHHXAGYDR-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.75 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|