C10H14ClFN4O — CID 103552661
2-(4,6-diamino-3-chloro-2-fluoro-N-methylanilino)-N-methylacetamide (PubChem CID 103552661) has the molecular formula C10H14ClFN4O and a molecular weight of 260.70 g/mol. Its IUPAC name is 2-(4,6-diamino-3-chloro-2-fluoro-N-methylanilino)-N-methylacetamide.
| Compound Name | 2-(4,6-diamino-3-chloro-2-fluoro-N-methylanilino)-N-methylacetamide |
|---|---|
| PubChem CID | 103552661 |
| Molecular Formula | C10H14ClFN4O |
| Molecular Weight | 260.70 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 2-(4,6-diamino-3-chloro-2-fluoro-N-methylanilino)-N-methylacetamide |
| SMILES | CNC(=O)CN(C)c1c(N)cc(N)c(Cl)c1F |
| InChI | InChI=1S/C10H14ClFN4O/c1-15-7(17)4-16(2)10-6(14)3-5(13)8(11)9(10)12/h3H,4,13-14H2,1-2H3,(H,15,17) |
| InChIKey | PMKALINKXDRMAR-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 84.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.70 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|