C13H20ClFN4O — CID 103552811
2-(4,6-diamino-3-chloro-2-fluoro-N-methylanilino)-N,N-diethylacetamide (PubChem CID 103552811) has the molecular formula C13H20ClFN4O and a molecular weight of 302.78 g/mol. Its IUPAC name is 2-(4,6-diamino-3-chloro-2-fluoro-N-methylanilino)-N,N-diethylacetamide.
| Compound Name | 2-(4,6-diamino-3-chloro-2-fluoro-N-methylanilino)-N,N-diethylacetamide |
|---|---|
| PubChem CID | 103552811 |
| Molecular Formula | C13H20ClFN4O |
| Molecular Weight | 302.78 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 2-(4,6-diamino-3-chloro-2-fluoro-N-methylanilino)-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)CN(C)c1c(N)cc(N)c(Cl)c1F |
| InChI | InChI=1S/C13H20ClFN4O/c1-4-19(5-2)10(20)7-18(3)13-9(17)6-8(16)11(14)12(13)15/h6H,4-5,7,16-17H2,1-3H3 |
| InChIKey | HSRZACFGTTVZRX-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 75.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.78 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|