C12H18ClFN4O — CID 103553561
2-(4,6-diamino-3-chloro-2-fluoroanilino)-N-ethyl-N-methylpropanamide (PubChem CID 103553561) has the molecular formula C12H18ClFN4O and a molecular weight of 288.75 g/mol. Its IUPAC name is 2-(4,6-diamino-3-chloro-2-fluoroanilino)-N-ethyl-N-methylpropanamide.
| Compound Name | 2-(4,6-diamino-3-chloro-2-fluoroanilino)-N-ethyl-N-methylpropanamide |
|---|---|
| PubChem CID | 103553561 |
| Molecular Formula | C12H18ClFN4O |
| Molecular Weight | 288.75 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | 2-(4,6-diamino-3-chloro-2-fluoroanilino)-N-ethyl-N-methylpropanamide |
| SMILES | CCN(C)C(=O)C(C)Nc1c(N)cc(N)c(Cl)c1F |
| InChI | InChI=1S/C12H18ClFN4O/c1-4-18(3)12(19)6(2)17-11-8(16)5-7(15)9(13)10(11)14/h5-6,17H,4,15-16H2,1-3H3 |
| InChIKey | RDMRKRCYQODVCE-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 84.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.75 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|