C11H18ClFN4 — CID 103553047
5-chloro-1-N-[2-[ethyl(methyl)amino]ethyl]-6-fluorobenzene-1,2,4-triamine (PubChem CID 103553047) has the molecular formula C11H18ClFN4 and a molecular weight of 260.74 g/mol. Its IUPAC name is 5-chloro-1-N-[2-[ethyl(methyl)amino]ethyl]-6-fluorobenzene-1,2,4-triamine.
| Compound Name | 5-chloro-1-N-[2-[ethyl(methyl)amino]ethyl]-6-fluorobenzene-1,2,4-triamine |
|---|---|
| PubChem CID | 103553047 |
| Molecular Formula | C11H18ClFN4 |
| Molecular Weight | 260.74 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 5-chloro-1-N-[2-[ethyl(methyl)amino]ethyl]-6-fluorobenzene-1,2,4-triamine |
| SMILES | CCN(C)CCNc1c(N)cc(N)c(Cl)c1F |
| InChI | InChI=1S/C11H18ClFN4/c1-3-17(2)5-4-16-11-8(15)6-7(14)9(12)10(11)13/h6,16H,3-5,14-15H2,1-2H3 |
| InChIKey | ROFLUWSEDJMPOB-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 67.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.74 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|