C10H11ClFN5O — CID 106393058
5-chloro-6-fluoro-1-N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]benzene-1,2,4-triamine (PubChem CID 106393058) has the molecular formula C10H11ClFN5O and a molecular weight of 271.68 g/mol. Its IUPAC name is 5-chloro-6-fluoro-1-N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]benzene-1,2,4-triamine.
| Compound Name | 5-chloro-6-fluoro-1-N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]benzene-1,2,4-triamine |
|---|---|
| PubChem CID | 106393058 |
| Molecular Formula | C10H11ClFN5O |
| Molecular Weight | 271.68 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | 5-chloro-6-fluoro-1-N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]benzene-1,2,4-triamine |
| SMILES | Cc1nc(CNc2c(N)cc(N)c(Cl)c2F)no1 |
| InChI | InChI=1S/C10H11ClFN5O/c1-4-16-7(17-18-4)3-15-10-6(14)2-5(13)8(11)9(10)12/h2,15H,3,13-14H2,1H3 |
| InChIKey | VYBPWIIOIOEEQH-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 102.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.68 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|