C10H7F4N3O — CID 107912090
2,3,5,6-tetrafluoro-N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]aniline (PubChem CID 107912090) has the molecular formula C10H7F4N3O and a molecular weight of 261.18 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]aniline.
| Compound Name | 2,3,5,6-tetrafluoro-N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]aniline |
|---|---|
| PubChem CID | 107912090 |
| Molecular Formula | C10H7F4N3O |
| Molecular Weight | 261.18 g/mol |
| Exact Mass | 261.05 |
| IUPAC Name | 2,3,5,6-tetrafluoro-N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]aniline |
| SMILES | Cc1nc(CNc2c(F)c(F)cc(F)c2F)no1 |
| InChI | InChI=1S/C10H7F4N3O/c1-4-16-7(17-18-4)3-15-10-8(13)5(11)2-6(12)9(10)14/h2,15H,3H2,1H3 |
| InChIKey | ODKFHCKXINLHDC-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.18 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|