C10H8F3N3O — CID 103742013
2,3,4-trifluoro-N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]aniline (PubChem CID 103742013) has the molecular formula C10H8F3N3O and a molecular weight of 243.19 g/mol. Its IUPAC name is 2,3,4-trifluoro-N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]aniline.
| Compound Name | 2,3,4-trifluoro-N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]aniline |
|---|---|
| PubChem CID | 103742013 |
| Molecular Formula | C10H8F3N3O |
| Molecular Weight | 243.19 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | 2,3,4-trifluoro-N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]aniline |
| SMILES | Cc1nc(CNc2ccc(F)c(F)c2F)no1 |
| InChI | InChI=1S/C10H8F3N3O/c1-5-15-8(16-17-5)4-14-7-3-2-6(11)9(12)10(7)13/h2-3,14H,4H2,1H3 |
| InChIKey | OUEZCAAFPMZTFR-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.19 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|