C13H15FN4O3 — CID 106407262
ethyl 2-amino-4-fluoro-5-[(5-methyl-1,2,4-oxadiazol-3-yl)methylamino]benzoate (PubChem CID 106407262) has the molecular formula C13H15FN4O3 and a molecular weight of 294.29 g/mol. Its IUPAC name is ethyl 2-amino-4-fluoro-5-[(5-methyl-1,2,4-oxadiazol-3-yl)methylamino]benzoate.
| Compound Name | ethyl 2-amino-4-fluoro-5-[(5-methyl-1,2,4-oxadiazol-3-yl)methylamino]benzoate |
|---|---|
| PubChem CID | 106407262 |
| Molecular Formula | C13H15FN4O3 |
| Molecular Weight | 294.29 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | ethyl 2-amino-4-fluoro-5-[(5-methyl-1,2,4-oxadiazol-3-yl)methylamino]benzoate |
| SMILES | CCOC(=O)c1cc(NCc2noc(C)n2)c(F)cc1N |
| InChI | InChI=1S/C13H15FN4O3/c1-3-20-13(19)8-4-11(9(14)5-10(8)15)16-6-12-17-7(2)21-18-12/h4-5,16H,3,6,15H2,1-2H3 |
| InChIKey | FKFZTICTFYFXRV-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 103.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.29 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|