C12H16N4O3 — CID 106393136
4,5-dimethoxy-2-N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]benzene-1,2-diamine (PubChem CID 106393136) has the molecular formula C12H16N4O3 and a molecular weight of 264.29 g/mol. Its IUPAC name is 4,5-dimethoxy-2-N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]benzene-1,2-diamine.
| Compound Name | 4,5-dimethoxy-2-N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 106393136 |
| Molecular Formula | C12H16N4O3 |
| Molecular Weight | 264.29 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 4,5-dimethoxy-2-N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]benzene-1,2-diamine |
| SMILES | COc1cc(N)c(NCc2noc(C)n2)cc1OC |
| InChI | InChI=1S/C12H16N4O3/c1-7-15-12(16-19-7)6-14-9-5-11(18-3)10(17-2)4-8(9)13/h4-5,14H,6,13H2,1-3H3 |
| InChIKey | YVIPXEAZPQTHAV-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 95.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.29 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|