C11H12N4O3 — CID 106407259
5-amino-2-[(5-methyl-1,2,4-oxadiazol-3-yl)methylamino]benzoic acid (PubChem CID 106407259) has the molecular formula C11H12N4O3 and a molecular weight of 248.24 g/mol. Its IUPAC name is 5-amino-2-[(5-methyl-1,2,4-oxadiazol-3-yl)methylamino]benzoic acid.
| Compound Name | 5-amino-2-[(5-methyl-1,2,4-oxadiazol-3-yl)methylamino]benzoic acid |
|---|---|
| PubChem CID | 106407259 |
| Molecular Formula | C11H12N4O3 |
| Molecular Weight | 248.24 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | 5-amino-2-[(5-methyl-1,2,4-oxadiazol-3-yl)methylamino]benzoic acid |
| SMILES | Cc1nc(CNc2ccc(N)cc2C(=O)O)no1 |
| InChI | InChI=1S/C11H12N4O3/c1-6-14-10(15-18-6)5-13-9-3-2-7(12)4-8(9)11(16)17/h2-4,13H,5,12H2,1H3,(H,16,17) |
| InChIKey | OSGNLZRDVQDTEI-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 114.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.24 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|