C15H22FN3O2 — CID 62978910
ethyl 2-amino-5-[2-[cyclopropyl(methyl)amino]ethylamino]-4-fluorobenzoate (PubChem CID 62978910) has the molecular formula C15H22FN3O2 and a molecular weight of 295.36 g/mol. Its IUPAC name is ethyl 2-amino-5-[2-[cyclopropyl(methyl)amino]ethylamino]-4-fluorobenzoate.
| Compound Name | ethyl 2-amino-5-[2-[cyclopropyl(methyl)amino]ethylamino]-4-fluorobenzoate |
|---|---|
| PubChem CID | 62978910 |
| Molecular Formula | C15H22FN3O2 |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | ethyl 2-amino-5-[2-[cyclopropyl(methyl)amino]ethylamino]-4-fluorobenzoate |
| SMILES | CCOC(=O)c1cc(NCCN(C)C2CC2)c(F)cc1N |
| InChI | InChI=1S/C15H22FN3O2/c1-3-21-15(20)11-8-14(12(16)9-13(11)17)18-6-7-19(2)10-4-5-10/h8-10,18H,3-7,17H2,1-2H3 |
| InChIKey | QNWKLKDDLAFQNC-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|