C13H18FN3O2 — CID 62978741
2-amino-5-[2-[cyclopropyl(methyl)amino]ethylamino]-4-fluorobenzoic acid (PubChem CID 62978741) has the molecular formula C13H18FN3O2 and a molecular weight of 267.30 g/mol. Its IUPAC name is 2-amino-5-[2-[cyclopropyl(methyl)amino]ethylamino]-4-fluorobenzoic acid.
| Compound Name | 2-amino-5-[2-[cyclopropyl(methyl)amino]ethylamino]-4-fluorobenzoic acid |
|---|---|
| PubChem CID | 62978741 |
| Molecular Formula | C13H18FN3O2 |
| Molecular Weight | 267.30 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | 2-amino-5-[2-[cyclopropyl(methyl)amino]ethylamino]-4-fluorobenzoic acid |
| SMILES | CN(CCNc1cc(C(=O)O)c(N)cc1F)C1CC1 |
| InChI | InChI=1S/C13H18FN3O2/c1-17(8-2-3-8)5-4-16-12-6-9(13(18)19)11(15)7-10(12)14/h6-8,16H,2-5,15H2,1H3,(H,18,19) |
| InChIKey | QVRGKBQWFYEDNN-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.30 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|