C15H22FN3O2 — CID 114516577
2-amino-4-fluoro-5-[2-(1-methylpiperidin-4-yl)ethylamino]benzoic acid (PubChem CID 114516577) has the molecular formula C15H22FN3O2 and a molecular weight of 295.36 g/mol. Its IUPAC name is 2-amino-4-fluoro-5-[2-(1-methylpiperidin-4-yl)ethylamino]benzoic acid.
| Compound Name | 2-amino-4-fluoro-5-[2-(1-methylpiperidin-4-yl)ethylamino]benzoic acid |
|---|---|
| PubChem CID | 114516577 |
| Molecular Formula | C15H22FN3O2 |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | 2-amino-4-fluoro-5-[2-(1-methylpiperidin-4-yl)ethylamino]benzoic acid |
| SMILES | CN1CCC(CCNc2cc(C(=O)O)c(N)cc2F)CC1 |
| InChI | InChI=1S/C15H22FN3O2/c1-19-6-3-10(4-7-19)2-5-18-14-8-11(15(20)21)13(17)9-12(14)16/h8-10,18H,2-7,17H2,1H3,(H,20,21) |
| InChIKey | YJNKABUZQZTMKR-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|