C14H15ClFN3O — CID 107231596
[4-[(4,6-diamino-3-chloro-2-fluoroanilino)methyl]phenyl]methanol (PubChem CID 107231596) has the molecular formula C14H15ClFN3O and a molecular weight of 295.75 g/mol. Its IUPAC name is [4-[(4,6-diamino-3-chloro-2-fluoroanilino)methyl]phenyl]methanol.
| Compound Name | [4-[(4,6-diamino-3-chloro-2-fluoroanilino)methyl]phenyl]methanol |
|---|---|
| PubChem CID | 107231596 |
| Molecular Formula | C14H15ClFN3O |
| Molecular Weight | 295.75 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | [4-[(4,6-diamino-3-chloro-2-fluoroanilino)methyl]phenyl]methanol |
| SMILES | Nc1cc(N)c(NCc2ccc(CO)cc2)c(F)c1Cl |
| InChI | InChI=1S/C14H15ClFN3O/c15-12-10(17)5-11(18)14(13(12)16)19-6-8-1-3-9(7-20)4-2-8/h1-5,19-20H,6-7,17-18H2 |
| InChIKey | BNEJNZSQOSVHJK-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.75 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|