C11H15ClFN3O — CID 103553357
[1-[(4,6-diamino-3-chloro-2-fluoroanilino)methyl]cyclopropyl]methanol (PubChem CID 103553357) has the molecular formula C11H15ClFN3O and a molecular weight of 259.71 g/mol. Its IUPAC name is [1-[(4,6-diamino-3-chloro-2-fluoroanilino)methyl]cyclopropyl]methanol.
| Compound Name | [1-[(4,6-diamino-3-chloro-2-fluoroanilino)methyl]cyclopropyl]methanol |
|---|---|
| PubChem CID | 103553357 |
| Molecular Formula | C11H15ClFN3O |
| Molecular Weight | 259.71 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | [1-[(4,6-diamino-3-chloro-2-fluoroanilino)methyl]cyclopropyl]methanol |
| SMILES | Nc1cc(N)c(NCC2(CO)CC2)c(F)c1Cl |
| InChI | InChI=1S/C11H15ClFN3O/c12-8-6(14)3-7(15)10(9(8)13)16-4-11(5-17)1-2-11/h3,16-17H,1-2,4-5,14-15H2 |
| InChIKey | PEEPOIMWPICFJF-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.71 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|