C11H14F2N2O — CID 115454129
[1-[(4-amino-2,6-difluoroanilino)methyl]cyclopropyl]methanol (PubChem CID 115454129) has the molecular formula C11H14F2N2O and a molecular weight of 228.24 g/mol. Its IUPAC name is [1-[(4-amino-2,6-difluoroanilino)methyl]cyclopropyl]methanol.
| Compound Name | [1-[(4-amino-2,6-difluoroanilino)methyl]cyclopropyl]methanol |
|---|---|
| PubChem CID | 115454129 |
| Molecular Formula | C11H14F2N2O |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | [1-[(4-amino-2,6-difluoroanilino)methyl]cyclopropyl]methanol |
| SMILES | Nc1cc(F)c(NCC2(CO)CC2)c(F)c1 |
| InChI | InChI=1S/C11H14F2N2O/c12-8-3-7(14)4-9(13)10(8)15-5-11(6-16)1-2-11/h3-4,15-16H,1-2,5-6,14H2 |
| InChIKey | RBGOXSUMGYBYMM-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|