C9H13ClFN3S — CID 103553150
5-chloro-6-fluoro-1-N-(2-methylsulfanylethyl)benzene-1,2,4-triamine (PubChem CID 103553150) has the molecular formula C9H13ClFN3S and a molecular weight of 249.74 g/mol. Its IUPAC name is 5-chloro-6-fluoro-1-N-(2-methylsulfanylethyl)benzene-1,2,4-triamine.
| Compound Name | 5-chloro-6-fluoro-1-N-(2-methylsulfanylethyl)benzene-1,2,4-triamine |
|---|---|
| PubChem CID | 103553150 |
| Molecular Formula | C9H13ClFN3S |
| Molecular Weight | 249.74 g/mol |
| Exact Mass | 249.05 |
| IUPAC Name | 5-chloro-6-fluoro-1-N-(2-methylsulfanylethyl)benzene-1,2,4-triamine |
| SMILES | CSCCNc1c(N)cc(N)c(Cl)c1F |
| InChI | InChI=1S/C9H13ClFN3S/c1-15-3-2-14-9-6(13)4-5(12)7(10)8(9)11/h4,14H,2-3,12-13H2,1H3 |
| InChIKey | DZKXKYHRTPTSNF-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.74 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|