C13H21ClFN3O — CID 106284341
1-(4,6-diamino-3-chloro-2-fluoroanilino)-3-ethylpentan-2-ol (PubChem CID 106284341) has the molecular formula C13H21ClFN3O and a molecular weight of 289.78 g/mol. Its IUPAC name is 1-(4,6-diamino-3-chloro-2-fluoroanilino)-3-ethylpentan-2-ol.
| Compound Name | 1-(4,6-diamino-3-chloro-2-fluoroanilino)-3-ethylpentan-2-ol |
|---|---|
| PubChem CID | 106284341 |
| Molecular Formula | C13H21ClFN3O |
| Molecular Weight | 289.78 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 1-(4,6-diamino-3-chloro-2-fluoroanilino)-3-ethylpentan-2-ol |
| SMILES | CCC(CC)C(O)CNc1c(N)cc(N)c(Cl)c1F |
| InChI | InChI=1S/C13H21ClFN3O/c1-3-7(4-2)10(19)6-18-13-9(17)5-8(16)11(14)12(13)15/h5,7,10,18-19H,3-4,6,16-17H2,1-2H3 |
| InChIKey | GKWCEFCFPFSPQJ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.78 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|