C13H21FN2O — CID 106284328
1-(2-amino-5-fluoroanilino)-3-ethylpentan-2-ol (PubChem CID 106284328) has the molecular formula C13H21FN2O and a molecular weight of 240.32 g/mol. Its IUPAC name is 1-(2-amino-5-fluoroanilino)-3-ethylpentan-2-ol.
| Compound Name | 1-(2-amino-5-fluoroanilino)-3-ethylpentan-2-ol |
|---|---|
| PubChem CID | 106284328 |
| Molecular Formula | C13H21FN2O |
| Molecular Weight | 240.32 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | 1-(2-amino-5-fluoroanilino)-3-ethylpentan-2-ol |
| SMILES | CCC(CC)C(O)CNc1cc(F)ccc1N |
| InChI | InChI=1S/C13H21FN2O/c1-3-9(4-2)13(17)8-16-12-7-10(14)5-6-11(12)15/h5-7,9,13,16-17H,3-4,8,15H2,1-2H3 |
| InChIKey | NFFCPKKGWZXBKI-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.32 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|