C14H19FN2O — CID 113243820
2-[(3-ethyl-2-hydroxypentyl)amino]-5-fluorobenzonitrile (PubChem CID 113243820) has the molecular formula C14H19FN2O and a molecular weight of 250.32 g/mol. Its IUPAC name is 2-[(3-ethyl-2-hydroxypentyl)amino]-5-fluorobenzonitrile.
| Compound Name | 2-[(3-ethyl-2-hydroxypentyl)amino]-5-fluorobenzonitrile |
|---|---|
| PubChem CID | 113243820 |
| Molecular Formula | C14H19FN2O |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | 2-[(3-ethyl-2-hydroxypentyl)amino]-5-fluorobenzonitrile |
| SMILES | CCC(CC)C(O)CNc1ccc(F)cc1C#N |
| InChI | InChI=1S/C14H19FN2O/c1-3-10(4-2)14(18)9-17-13-6-5-12(15)7-11(13)8-16/h5-7,10,14,17-18H,3-4,9H2,1-2H3 |
| InChIKey | FLBMBIFGHBLSFP-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 56.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |