C13H23N3O3S — CID 106284247
4-amino-3-[(3-ethyl-2-hydroxypentyl)amino]benzenesulfonamide (PubChem CID 106284247) has the molecular formula C13H23N3O3S and a molecular weight of 301.41 g/mol. Its IUPAC name is 4-amino-3-[(3-ethyl-2-hydroxypentyl)amino]benzenesulfonamide.
| Compound Name | 4-amino-3-[(3-ethyl-2-hydroxypentyl)amino]benzenesulfonamide |
|---|---|
| PubChem CID | 106284247 |
| Molecular Formula | C13H23N3O3S |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | 4-amino-3-[(3-ethyl-2-hydroxypentyl)amino]benzenesulfonamide |
| SMILES | CCC(CC)C(O)CNc1cc(S(N)(=O)=O)ccc1N |
| InChI | InChI=1S/C13H23N3O3S/c1-3-9(4-2)13(17)8-16-12-7-10(20(15,18)19)5-6-11(12)14/h5-7,9,13,16-17H,3-4,8,14H2,1-2H3,(H2,15,18,19) |
| InChIKey | RMWIIMCCCZDGGR-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 118.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|