C11H16ClFN4O — CID 106095656
3-(4,6-diamino-3-chloro-2-fluoroanilino)-3-methylbutanamide (PubChem CID 106095656) has the molecular formula C11H16ClFN4O and a molecular weight of 274.73 g/mol. Its IUPAC name is 3-(4,6-diamino-3-chloro-2-fluoroanilino)-3-methylbutanamide.
| Compound Name | 3-(4,6-diamino-3-chloro-2-fluoroanilino)-3-methylbutanamide |
|---|---|
| PubChem CID | 106095656 |
| Molecular Formula | C11H16ClFN4O |
| Molecular Weight | 274.73 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 3-(4,6-diamino-3-chloro-2-fluoroanilino)-3-methylbutanamide |
| SMILES | CC(C)(CC(N)=O)Nc1c(N)cc(N)c(Cl)c1F |
| InChI | InChI=1S/C11H16ClFN4O/c1-11(2,4-7(16)18)17-10-6(15)3-5(14)8(12)9(10)13/h3,17H,4,14-15H2,1-2H3,(H2,16,18) |
| InChIKey | JAKNNFOIWPNEMM-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 107.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.73 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|