C11H17ClFN5O — CID 103553391
3-[2-(4,6-diamino-3-chloro-2-fluoroanilino)ethyl]-1,1-dimethylurea (PubChem CID 103553391) has the molecular formula C11H17ClFN5O and a molecular weight of 289.74 g/mol. Its IUPAC name is 3-[2-(4,6-diamino-3-chloro-2-fluoroanilino)ethyl]-1,1-dimethylurea.
| Compound Name | 3-[2-(4,6-diamino-3-chloro-2-fluoroanilino)ethyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 103553391 |
| Molecular Formula | C11H17ClFN5O |
| Molecular Weight | 289.74 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 3-[2-(4,6-diamino-3-chloro-2-fluoroanilino)ethyl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)NCCNc1c(N)cc(N)c(Cl)c1F |
| InChI | InChI=1S/C11H17ClFN5O/c1-18(2)11(19)17-4-3-16-10-7(15)5-6(14)8(12)9(10)13/h5,16H,3-4,14-15H2,1-2H3,(H,17,19) |
| InChIKey | ZZTVSCWRPQTVEH-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 96.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.74 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|