C11H17FN4O — CID 83116888
3-[2-(2-amino-3-fluoroanilino)ethyl]-1,1-dimethylurea (PubChem CID 83116888) has the molecular formula C11H17FN4O and a molecular weight of 240.28 g/mol. Its IUPAC name is 3-[2-(2-amino-3-fluoroanilino)ethyl]-1,1-dimethylurea.
| Compound Name | 3-[2-(2-amino-3-fluoroanilino)ethyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 83116888 |
| Molecular Formula | C11H17FN4O |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 3-[2-(2-amino-3-fluoroanilino)ethyl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)NCCNc1cccc(F)c1N |
| InChI | InChI=1S/C11H17FN4O/c1-16(2)11(17)15-7-6-14-9-5-3-4-8(12)10(9)13/h3-5,14H,6-7,13H2,1-2H3,(H,15,17) |
| InChIKey | ATIVFGOPGKZUBX-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|