C12H17FN4OS — CID 83121325
3-[2-(4-carbamothioyl-2-fluoroanilino)ethyl]-1,1-dimethylurea (PubChem CID 83121325) has the molecular formula C12H17FN4OS and a molecular weight of 284.36 g/mol. Its IUPAC name is 3-[2-(4-carbamothioyl-2-fluoroanilino)ethyl]-1,1-dimethylurea.
| Compound Name | 3-[2-(4-carbamothioyl-2-fluoroanilino)ethyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 83121325 |
| Molecular Formula | C12H17FN4OS |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 3-[2-(4-carbamothioyl-2-fluoroanilino)ethyl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)NCCNc1ccc(C(N)=S)cc1F |
| InChI | InChI=1S/C12H17FN4OS/c1-17(2)12(18)16-6-5-15-10-4-3-8(11(14)19)7-9(10)13/h3-4,7,15H,5-6H2,1-2H3,(H2,14,19)(H,16,18) |
| InChIKey | FAKBZPWNOAYHHK-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|