C12H16FN3OS — CID 54950945
2-(4-carbamothioyl-2-fluoroanilino)-N,N-dimethylpropanamide (PubChem CID 54950945) has the molecular formula C12H16FN3OS and a molecular weight of 269.35 g/mol. Its IUPAC name is 2-(4-carbamothioyl-2-fluoroanilino)-N,N-dimethylpropanamide.
| Compound Name | 2-(4-carbamothioyl-2-fluoroanilino)-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 54950945 |
| Molecular Formula | C12H16FN3OS |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | 2-(4-carbamothioyl-2-fluoroanilino)-N,N-dimethylpropanamide |
| SMILES | CC(Nc1ccc(C(N)=S)cc1F)C(=O)N(C)C |
| InChI | InChI=1S/C12H16FN3OS/c1-7(12(17)16(2)3)15-10-5-4-8(11(14)18)6-9(10)13/h4-7,15H,1-3H3,(H2,14,18) |
| InChIKey | BIPRFZJAHZZOTN-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|