C14H22FN3S — CID 43657729
4-[[3-(dimethylamino)-2,2-dimethylpropyl]amino]-3-fluorobenzenecarbothioamide (PubChem CID 43657729) has the molecular formula C14H22FN3S and a molecular weight of 283.42 g/mol. Its IUPAC name is 4-[[3-(dimethylamino)-2,2-dimethylpropyl]amino]-3-fluorobenzenecarbothioamide.
| Compound Name | 4-[[3-(dimethylamino)-2,2-dimethylpropyl]amino]-3-fluorobenzenecarbothioamide |
|---|---|
| PubChem CID | 43657729 |
| Molecular Formula | C14H22FN3S |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | 4-[[3-(dimethylamino)-2,2-dimethylpropyl]amino]-3-fluorobenzenecarbothioamide |
| SMILES | CN(C)CC(C)(C)CNc1ccc(C(N)=S)cc1F |
| InChI | InChI=1S/C14H22FN3S/c1-14(2,9-18(3)4)8-17-12-6-5-10(13(16)19)7-11(12)15/h5-7,17H,8-9H2,1-4H3,(H2,16,19) |
| InChIKey | MVNDNNRCKDPCBL-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|