C11H12FN5S — CID 114125574
3-fluoro-4-[(1-methyl-1,2,4-triazol-3-yl)methylamino]benzenecarbothioamide (PubChem CID 114125574) has the molecular formula C11H12FN5S and a molecular weight of 265.32 g/mol. Its IUPAC name is 3-fluoro-4-[(1-methyl-1,2,4-triazol-3-yl)methylamino]benzenecarbothioamide.
| Compound Name | 3-fluoro-4-[(1-methyl-1,2,4-triazol-3-yl)methylamino]benzenecarbothioamide |
|---|---|
| PubChem CID | 114125574 |
| Molecular Formula | C11H12FN5S |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.08 |
| IUPAC Name | 3-fluoro-4-[(1-methyl-1,2,4-triazol-3-yl)methylamino]benzenecarbothioamide |
| SMILES | Cn1cnc(CNc2ccc(C(N)=S)cc2F)n1 |
| InChI | InChI=1S/C11H12FN5S/c1-17-6-15-10(16-17)5-14-9-3-2-7(11(13)18)4-8(9)12/h2-4,6,14H,5H2,1H3,(H2,13,18) |
| InChIKey | MSXNAXYYAATJGE-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|