C10H12N6S — CID 114125573
3-[(1-methyl-1,2,4-triazol-3-yl)methylamino]pyridine-2-carbothioamide (PubChem CID 114125573) has the molecular formula C10H12N6S and a molecular weight of 248.32 g/mol. Its IUPAC name is 3-[(1-methyl-1,2,4-triazol-3-yl)methylamino]pyridine-2-carbothioamide.
| Compound Name | 3-[(1-methyl-1,2,4-triazol-3-yl)methylamino]pyridine-2-carbothioamide |
|---|---|
| PubChem CID | 114125573 |
| Molecular Formula | C10H12N6S |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 3-[(1-methyl-1,2,4-triazol-3-yl)methylamino]pyridine-2-carbothioamide |
| SMILES | Cn1cnc(CNc2cccnc2C(N)=S)n1 |
| InChI | InChI=1S/C10H12N6S/c1-16-6-14-8(15-16)5-13-7-3-2-4-12-9(7)10(11)17/h2-4,6,13H,5H2,1H3,(H2,11,17) |
| InChIKey | WUIPKLIFAFPMDK-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|