C11H14N4O — CID 103884596
2-[[(1-methyl-1,2,4-triazol-3-yl)methylamino]methyl]phenol (PubChem CID 103884596) has the molecular formula C11H14N4O and a molecular weight of 218.26 g/mol. Its IUPAC name is 2-[[(1-methyl-1,2,4-triazol-3-yl)methylamino]methyl]phenol.
| Compound Name | 2-[[(1-methyl-1,2,4-triazol-3-yl)methylamino]methyl]phenol |
|---|---|
| PubChem CID | 103884596 |
| Molecular Formula | C11H14N4O |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 2-[[(1-methyl-1,2,4-triazol-3-yl)methylamino]methyl]phenol |
| SMILES | Cn1cnc(CNCc2ccccc2O)n1 |
| InChI | InChI=1S/C11H14N4O/c1-15-8-13-11(14-15)7-12-6-9-4-2-3-5-10(9)16/h2-5,8,12,16H,6-7H2,1H3 |
| InChIKey | SHGYMXWNYDZWND-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|