C11H14N4O2 — CID 103953804
4-[[(1-methyl-1,2,4-triazol-3-yl)methylamino]methyl]benzene-1,2-diol (PubChem CID 103953804) has the molecular formula C11H14N4O2 and a molecular weight of 234.26 g/mol. Its IUPAC name is 4-[[(1-methyl-1,2,4-triazol-3-yl)methylamino]methyl]benzene-1,2-diol.
| Compound Name | 4-[[(1-methyl-1,2,4-triazol-3-yl)methylamino]methyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 103953804 |
| Molecular Formula | C11H14N4O2 |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | 4-[[(1-methyl-1,2,4-triazol-3-yl)methylamino]methyl]benzene-1,2-diol |
| SMILES | Cn1cnc(CNCc2ccc(O)c(O)c2)n1 |
| InChI | InChI=1S/C11H14N4O2/c1-15-7-13-11(14-15)6-12-5-8-2-3-9(16)10(17)4-8/h2-4,7,12,16-17H,5-6H2,1H3 |
| InChIKey | YCAYTRGVHUVZNG-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 83.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|