C13H17N3O2 — CID 112668482
4-[[(1,3-dimethylpyrazol-4-yl)methylamino]methyl]benzene-1,2-diol (PubChem CID 112668482) has the molecular formula C13H17N3O2 and a molecular weight of 247.30 g/mol. Its IUPAC name is 4-[[(1,3-dimethylpyrazol-4-yl)methylamino]methyl]benzene-1,2-diol.
| Compound Name | 4-[[(1,3-dimethylpyrazol-4-yl)methylamino]methyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 112668482 |
| Molecular Formula | C13H17N3O2 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | 4-[[(1,3-dimethylpyrazol-4-yl)methylamino]methyl]benzene-1,2-diol |
| SMILES | Cc1nn(C)cc1CNCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C13H17N3O2/c1-9-11(8-16(2)15-9)7-14-6-10-3-4-12(17)13(18)5-10/h3-5,8,14,17-18H,6-7H2,1-2H3 |
| InChIKey | LSZWMUGPIHHRBO-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|