C13H13N5 — CID 103883678
N-[(1-methyl-1,2,4-triazol-3-yl)methyl]quinolin-4-amine (PubChem CID 103883678) has the molecular formula C13H13N5 and a molecular weight of 239.28 g/mol. Its IUPAC name is N-[(1-methyl-1,2,4-triazol-3-yl)methyl]quinolin-4-amine.
| Compound Name | N-[(1-methyl-1,2,4-triazol-3-yl)methyl]quinolin-4-amine |
|---|---|
| PubChem CID | 103883678 |
| Molecular Formula | C13H13N5 |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | N-[(1-methyl-1,2,4-triazol-3-yl)methyl]quinolin-4-amine |
| SMILES | Cn1cnc(CNc2ccnc3ccccc23)n1 |
| InChI | InChI=1S/C13H13N5/c1-18-9-16-13(17-18)8-15-12-6-7-14-11-5-3-2-4-10(11)12/h2-7,9H,8H2,1H3,(H,14,15) |
| InChIKey | RVLYFZFRTWWPMU-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |