C9H11N7S — CID 114125566
2-[(1-methyl-1,2,4-triazol-3-yl)methylamino]pyrimidine-4-carbothioamide (PubChem CID 114125566) has the molecular formula C9H11N7S and a molecular weight of 249.30 g/mol. Its IUPAC name is 2-[(1-methyl-1,2,4-triazol-3-yl)methylamino]pyrimidine-4-carbothioamide.
| Compound Name | 2-[(1-methyl-1,2,4-triazol-3-yl)methylamino]pyrimidine-4-carbothioamide |
|---|---|
| PubChem CID | 114125566 |
| Molecular Formula | C9H11N7S |
| Molecular Weight | 249.30 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | 2-[(1-methyl-1,2,4-triazol-3-yl)methylamino]pyrimidine-4-carbothioamide |
| SMILES | Cn1cnc(CNc2nccc(C(N)=S)n2)n1 |
| InChI | InChI=1S/C9H11N7S/c1-16-5-13-7(15-16)4-12-9-11-3-2-6(14-9)8(10)17/h2-3,5H,4H2,1H3,(H2,10,17)(H,11,12,14) |
| InChIKey | VKGFFKWMLFIHDK-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 94.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.30 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|